C12H10N2O5 — CID 155177543
3-(7-hydroxy-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione (PubChem CID 155177543) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 3-(7-hydroxy-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-hydroxy-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 155177543 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-(7-hydroxy-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3c(O)cccc32)C(=O)N1 |
| InChI | InChI=1S/C12H10N2O5/c15-8-3-1-2-6-10(8)19-12(18)14(6)7-4-5-9(16)13-11(7)17/h1-3,7,15H,4-5H2,(H,13,16,17) |
| InChIKey | XCDLPSXDVANXRJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|