C24H33N3O8 — CID 138695486
tert-butyl-[2-[2-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]ethoxy]ethyl]carbamic acid (PubChem CID 138695486) has the molecular formula C24H33N3O8 and a molecular weight of 491.54 g/mol. Its IUPAC name is tert-butyl-[2-[2-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]ethoxy]ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-[2-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]ethoxy]ethyl]carbamic acid |
|---|---|
| PubChem CID | 138695486 |
| Molecular Formula | C24H33N3O8 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | tert-butyl-[2-[2-[3-[3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-benzoxazol-7-yl]propoxy]ethoxy]ethyl]carbamic acid |
| SMILES | CC(C)(C)N(CCOCCOCCCc1cccc2c1oc(=O)n2C1CCC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C24H33N3O8/c1-24(2,3)26(22(30)31)11-13-34-15-14-33-12-5-7-16-6-4-8-17-20(16)35-23(32)27(17)18-9-10-19(28)25-21(18)29/h4,6,8,18H,5,7,9-15H2,1-3H3,(H,30,31)(H,25,28,29) |
| InChIKey | WNEXXMVDQTWUPG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|