C15H16N2O4 — CID 163611115
3-(2-oxo-4-propan-2-yl-1,3-benzoxazol-3-yl)piperidine-2,6-dione (PubChem CID 163611115) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-(2-oxo-4-propan-2-yl-1,3-benzoxazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-oxo-4-propan-2-yl-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 163611115 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-(2-oxo-4-propan-2-yl-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| SMILES | CC(C)c1cccc2oc(=O)n(C3CCC(=O)NC3=O)c12 |
| InChI | InChI=1S/C15H16N2O4/c1-8(2)9-4-3-5-11-13(9)17(15(20)21-11)10-6-7-12(18)16-14(10)19/h3-5,8,10H,6-7H2,1-2H3,(H,16,18,19) |
| InChIKey | HFZJSKYTGWENGT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|