C19H20F2N4O2 — CID 175880196
3-[5-(3,8-diazabicyclo[3.2.1]octan-8-yl)-4,6-difluoroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 175880196) has the molecular formula C19H20F2N4O2 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-[5-(3,8-diazabicyclo[3.2.1]octan-8-yl)-4,6-difluoroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(3,8-diazabicyclo[3.2.1]octan-8-yl)-4,6-difluoroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175880196 |
| Molecular Formula | C19H20F2N4O2 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-[5-(3,8-diazabicyclo[3.2.1]octan-8-yl)-4,6-difluoroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc3cc(F)c(N4C5CCC4CNC5)c(F)c3c2)C(=O)N1 |
| InChI | InChI=1S/C19H20F2N4O2/c20-14-5-10-8-24(15-3-4-16(26)23-19(15)27)9-13(10)17(21)18(14)25-11-1-2-12(25)7-22-6-11/h5,8-9,11-12,15,22H,1-4,6-7H2,(H,23,26,27) |
| InChIKey | QRHGCDUVLVMRJN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|