C13H11FN2O4 — CID 175801319
3-(5-fluoro-1,3-dihydroxyisoindol-2-yl)piperidine-2,6-dione (PubChem CID 175801319) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-(5-fluoro-1,3-dihydroxyisoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-fluoro-1,3-dihydroxyisoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 175801319 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(5-fluoro-1,3-dihydroxyisoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(O)c3ccc(F)cc3c2O)C(=O)N1 |
| InChI | InChI=1S/C13H11FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9,19-20H,3-4H2,(H,15,17,18) |
| InChIKey | SGEKCJPOHQLSOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|