C12H9FN2O3Se — CID 160690351
3-(6-fluoro-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione (PubChem CID 160690351) has the molecular formula C12H9FN2O3Se and a molecular weight of 327.17 g/mol. Its IUPAC name is 3-(6-fluoro-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-fluoro-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 160690351 |
| Molecular Formula | C12H9FN2O3Se |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 3-(6-fluoro-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2[se]c3cc(F)ccc3c2=O)C(=O)N1 |
| InChI | InChI=1S/C12H9FN2O3Se/c13-6-1-2-7-9(5-6)19-15(12(7)18)8-3-4-10(16)14-11(8)17/h1-2,5,8H,3-4H2,(H,14,16,17) |
| InChIKey | WETLHGKGPPAPQC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|