C13H12N2O4Se — CID 157440550
3-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione (PubChem CID 157440550) has the molecular formula C13H12N2O4Se and a molecular weight of 339.21 g/mol. Its IUPAC name is 3-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 157440550 |
| Molecular Formula | C13H12N2O4Se |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 3-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)piperidine-2,6-dione |
| SMILES | COc1cccc2c(=O)n(C3CCC(=O)NC3=O)[se]c12 |
| InChI | InChI=1S/C13H12N2O4Se/c1-19-9-4-2-3-7-11(9)20-15(13(7)18)8-5-6-10(16)14-12(8)17/h2-4,8H,5-6H2,1H3,(H,14,16,17) |
| InChIKey | JWJYGYDTUUMZFM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|