C22H20N4O6 — CID 136658572
1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methoxyphenyl)urea (PubChem CID 136658572) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 136658572 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)N=Cc1cccc2c(O)n(C3CCC(=O)NC3=O)c(O)c12 |
| InChI | InChI=1S/C22H20N4O6/c1-32-16-8-3-2-7-14(16)24-22(31)23-11-12-5-4-6-13-18(12)21(30)26(20(13)29)15-9-10-17(27)25-19(15)28/h2-8,11,15,29-30H,9-10H2,1H3,(H,24,31)(H,25,27,28) |
| InChIKey | RXKHGEJHIMTKIZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|