C22H20N4O5 — CID 136627530
1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methylphenyl)urea (PubChem CID 136627530) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 136627530 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)N=Cc1cccc2c(O)n(C3CCC(=O)NC3=O)c(O)c12 |
| InChI | InChI=1S/C22H20N4O5/c1-12-5-2-3-8-15(12)24-22(31)23-11-13-6-4-7-14-18(13)21(30)26(20(14)29)16-9-10-17(27)25-19(16)28/h2-8,11,16,29-30H,9-10H2,1H3,(H,24,31)(H,25,27,28) |
| InChIKey | SKNJUQIPZXQMTE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|