C17H17N5O5 — CID 155044289
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]iminoazetidine-3-carboxamide (PubChem CID 155044289) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]iminoazetidine-3-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]iminoazetidine-3-carboxamide |
|---|---|
| PubChem CID | 155044289 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]iminoazetidine-3-carboxamide |
| SMILES | O=C1CCC(n2c(O)c3cccc(/N=N/C(=O)C4CNC4)c3c2O)C(=O)N1 |
| InChI | InChI=1S/C17H17N5O5/c23-12-5-4-11(15(25)19-12)22-16(26)9-2-1-3-10(13(9)17(22)27)20-21-14(24)8-6-18-7-8/h1-3,8,11,18,26-27H,4-7H2,(H,19,23,25)/b21-20+ |
| InChIKey | PBBUTDVCPWFKGD-QZQOTICOSA-N |
| XLogP | 0.86 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|