C23H17ClN8O6S — CID 166718386
5-[(2-chloro-4-pyridinyl)carbamoylamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]imino-1,2-thiazole-3-carboxamide (PubChem CID 166718386) has the molecular formula C23H17ClN8O6S and a molecular weight of 568.96 g/mol. Its IUPAC name is 5-[(2-chloro-4-pyridinyl)carbamoylamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]imino-1,2-thiazole-3-carboxamide.
| Compound Name | 5-[(2-chloro-4-pyridinyl)carbamoylamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]imino-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 166718386 |
| Molecular Formula | C23H17ClN8O6S |
| Molecular Weight | 568.96 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | 5-[(2-chloro-4-pyridinyl)carbamoylamino]-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]imino-1,2-thiazole-3-carboxamide |
| SMILES | O=C1CCC(n2c(O)c3cccc(/N=N/C(=O)c4cc(NC(=O)Nc5ccnc(Cl)c5)sn4)c3c2O)C(=O)N1 |
| InChI | InChI=1S/C23H17ClN8O6S/c24-15-8-10(6-7-25-15)26-23(38)28-17-9-13(31-39-17)19(34)30-29-12-3-1-2-11-18(12)22(37)32(21(11)36)14-4-5-16(33)27-20(14)35/h1-3,6-9,14,36-37H,4-5H2,(H,27,33,35)(H2,25,26,28,38)/b30-29+ |
| InChIKey | CTQDGLZUBCHJPE-QVIHXGFCSA-N |
| XLogP | 4.10 |
| TPSA | 200.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|