C35H27ClN8O6 — CID 156829965
3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]benzamide (PubChem CID 156829965) has the molecular formula C35H27ClN8O6 and a molecular weight of 691.10 g/mol. Its IUPAC name is 3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]benzamide.
| Compound Name | 3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 156829965 |
| Molecular Formula | C35H27ClN8O6 |
| Molecular Weight | 691.10 g/mol |
| Exact Mass | 690.17 |
| IUPAC Name | 3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCNC(=O)c4cccc(C#Cc5cc(NC(=O)Nc6ccnc(Cl)c6)ccn5)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H27ClN8O6/c36-28-19-24(12-14-39-28)42-35(50)41-23-11-13-37-22(18-23)8-7-20-3-1-4-21(17-20)31(46)40-16-15-38-26-6-2-5-25-30(26)34(49)44(33(25)48)27-9-10-29(45)43-32(27)47/h1-6,11-14,17-19,27,38H,9-10,15-16H2,(H,40,46)(H,43,45,47)(H2,37,39,41,42,50) |
| InChIKey | HSKVUSPVILRTJA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 191.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|