C27H31N5O8 — CID 156883114
4-amino-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]-3-methoxybenzamide (PubChem CID 156883114) has the molecular formula C27H31N5O8 and a molecular weight of 553.57 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]-3-methoxybenzamide.
| Compound Name | 4-amino-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 156883114 |
| Molecular Formula | C27H31N5O8 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 4-amino-N-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)ccc1N |
| InChI | InChI=1S/C27H31N5O8/c1-38-21-15-16(5-6-18(21)28)24(34)30-10-12-40-14-13-39-11-9-29-19-4-2-3-17-23(19)27(37)32(26(17)36)20-7-8-22(33)31-25(20)35/h2-6,15,20,29H,7-14,28H2,1H3,(H,30,34)(H,31,33,35) |
| InChIKey | YYFFFIVEGFDIHY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 178.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|