C29H26N4O6 — CID 178099817
4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]-N-(2-phenoxyethyl)benzamide (PubChem CID 178099817) has the molecular formula C29H26N4O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is 4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 178099817 |
| Molecular Formula | C29H26N4O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]-N-(2-phenoxyethyl)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCc4ccc(C(=O)NCCOc5ccccc5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H26N4O6/c34-24-14-13-23(27(36)32-24)33-28(37)21-7-4-8-22(25(21)29(33)38)31-17-18-9-11-19(12-10-18)26(35)30-15-16-39-20-5-2-1-3-6-20/h1-12,23,31H,13-17H2,(H,30,35)(H,32,34,36) |
| InChIKey | ZRTUUMVQACDOGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|