C26H30N6O6 — CID 174319063
tert-butyl N-[4-[1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]diazenyl]ethylamino]phenyl]carbamate (PubChem CID 174319063) has the molecular formula C26H30N6O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is tert-butyl N-[4-[1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]diazenyl]ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]diazenyl]ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 174319063 |
| Molecular Formula | C26H30N6O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | tert-butyl N-[4-[1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]diazenyl]ethylamino]phenyl]carbamate |
| SMILES | CC(/N=N/c1cccc2c(O)n(C3CCC(=O)NC3=O)c(O)c12)Nc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H30N6O6/c1-14(27-15-8-10-16(11-9-15)28-25(37)38-26(2,3)4)30-31-18-7-5-6-17-21(18)24(36)32(23(17)35)19-12-13-20(33)29-22(19)34/h5-11,14,19,27,35-36H,12-13H2,1-4H3,(H,28,37)(H,29,33,34)/b31-30+ |
| InChIKey | ONGCSGOJZFKBQY-NVQSTNCTSA-N |
| XLogP | 4.92 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|