C22H19ClN4O5 — CID 136629073
1-(3-chloro-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]urea (PubChem CID 136629073) has the molecular formula C22H19ClN4O5 and a molecular weight of 454.87 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]urea |
|---|---|
| PubChem CID | 136629073 |
| Molecular Formula | C22H19ClN4O5 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxyisoindol-4-yl]methylidene]urea |
| SMILES | Cc1ccc(NC(=O)N=Cc2cccc3c(O)n(C4CCC(=O)NC4=O)c(O)c23)cc1Cl |
| InChI | InChI=1S/C22H19ClN4O5/c1-11-5-6-13(9-15(11)23)25-22(32)24-10-12-3-2-4-14-18(12)21(31)27(20(14)30)16-7-8-17(28)26-19(16)29/h2-6,9-10,16,30-31H,7-8H2,1H3,(H,25,32)(H,26,28,29) |
| InChIKey | GNJJVYQVOLGZAX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|