C24H25ClN6O5 — CID 146666236
1-[(R)-amino-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]methyl]-3-(3-chloro-4-methylphenyl)urea (PubChem CID 146666236) has the molecular formula C24H25ClN6O5 and a molecular weight of 512.95 g/mol. Its IUPAC name is 1-[(R)-amino-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]methyl]-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-[(R)-amino-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]methyl]-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 146666236 |
| Molecular Formula | C24H25ClN6O5 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-[(R)-amino-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrolidin-3-yl]amino]phenyl]methyl]-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N[C@@H](N)c2cccc(NC3CC(=O)N(C4CCC(=O)NC4=O)C3=O)c2)cc1Cl |
| InChI | InChI=1S/C24H25ClN6O5/c1-12-5-6-15(10-16(12)25)28-24(36)30-21(26)13-3-2-4-14(9-13)27-17-11-20(33)31(23(17)35)18-7-8-19(32)29-22(18)34/h2-6,9-10,17-18,21,27H,7-8,11,26H2,1H3,(H2,28,30,36)(H,29,32,34)/t17?,18?,21-/m1/s1 |
| InChIKey | HXDWXZJNEMUNIF-WIXQSORDSA-N |
| XLogP | 1.77 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|