C24H21ClN4O6 — CID 167099940
1-(3-chloro-4-methylphenyl)-3-[[3-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,5-dioxopyrrol-3-yl]oxyphenyl]methyl]urea (PubChem CID 167099940) has the molecular formula C24H21ClN4O6 and a molecular weight of 496.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[3-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,5-dioxopyrrol-3-yl]oxyphenyl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[3-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,5-dioxopyrrol-3-yl]oxyphenyl]methyl]urea |
|---|---|
| PubChem CID | 167099940 |
| Molecular Formula | C24H21ClN4O6 |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[3-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,5-dioxopyrrol-3-yl]oxyphenyl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2cccc(OC3=CC(=O)N([C@@H]4CCC(=O)NC4=O)C3=O)c2)cc1Cl |
| InChI | InChI=1S/C24H21ClN4O6/c1-13-5-6-15(10-17(13)25)27-24(34)26-12-14-3-2-4-16(9-14)35-19-11-21(31)29(23(19)33)18-7-8-20(30)28-22(18)32/h2-6,9-11,18H,7-8,12H2,1H3,(H2,26,27,34)(H,28,30,32)/t18-/m1/s1 |
| InChIKey | JMAPBKXXKFDMMG-GOSISDBHSA-N |
| XLogP | 2.41 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|