C25H22ClN3O5 — CID 165005672
3-[3-[4-[3-(3-chloro-4-methylphenyl)-2-oxopropyl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 165005672) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is 3-[3-[4-[3-(3-chloro-4-methylphenyl)-2-oxopropyl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[4-[3-(3-chloro-4-methylphenyl)-2-oxopropyl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165005672 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 3-[3-[4-[3-(3-chloro-4-methylphenyl)-2-oxopropyl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(CC(=O)Cc2ccc(NC3=CC(=O)N(C4CCC(=O)NC4=O)C3=O)cc2)cc1Cl |
| InChI | InChI=1S/C25H22ClN3O5/c1-14-2-3-16(12-19(14)26)11-18(30)10-15-4-6-17(7-5-15)27-20-13-23(32)29(25(20)34)21-8-9-22(31)28-24(21)33/h2-7,12-13,21,27H,8-11H2,1H3,(H,28,31,33) |
| InChIKey | IXQLNHSLLRJCON-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|