C28H28ClN3O5 — CID 165071940
3-[3-[3-[6-(4-chloro-3-methylphenyl)-4-oxohexan-2-yl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 165071940) has the molecular formula C28H28ClN3O5 and a molecular weight of 522.00 g/mol. Its IUPAC name is 3-[3-[3-[6-(4-chloro-3-methylphenyl)-4-oxohexan-2-yl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[3-[6-(4-chloro-3-methylphenyl)-4-oxohexan-2-yl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165071940 |
| Molecular Formula | C28H28ClN3O5 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 3-[3-[3-[6-(4-chloro-3-methylphenyl)-4-oxohexan-2-yl]anilino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1cc(CCC(=O)CC(C)c2cccc(NC3=CC(=O)N(C4CCC(=O)NC4=O)C3=O)c2)ccc1Cl |
| InChI | InChI=1S/C28H28ClN3O5/c1-16(13-21(33)8-6-18-7-9-22(29)17(2)12-18)19-4-3-5-20(14-19)30-23-15-26(35)32(28(23)37)24-10-11-25(34)31-27(24)36/h3-5,7,9,12,14-16,24,30H,6,8,10-11,13H2,1-2H3,(H,31,34,36) |
| InChIKey | SXIUSMYPEYIWHE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|