C27H26ClN3O4 — CID 165002748
3-[3-[5-(3-chlorophenyl)-4-oxopentan-2-yl]anilino]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione (PubChem CID 165002748) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 3-[3-[5-(3-chlorophenyl)-4-oxopentan-2-yl]anilino]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[3-[5-(3-chlorophenyl)-4-oxopentan-2-yl]anilino]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 165002748 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[3-[5-(3-chlorophenyl)-4-oxopentan-2-yl]anilino]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione |
| SMILES | C=C1CCC(N2C(=O)C=C(Nc3cccc(C(C)CC(=O)Cc4cccc(Cl)c4)c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H26ClN3O4/c1-16(11-22(32)13-18-5-3-7-20(28)12-18)19-6-4-8-21(14-19)30-23-15-25(33)31(27(23)35)24-10-9-17(2)29-26(24)34/h3-8,12,14-16,24,30H,2,9-11,13H2,1H3,(H,29,34) |
| InChIKey | OBQGLVGRZYOYOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|