C19H20N4O5 — CID 146666744
3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-methylpropanamide (PubChem CID 146666744) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-methylpropanamide.
| Compound Name | 3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 146666744 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-N-methylpropanamide |
| SMILES | CNC(=O)CCc1cccc(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)c1 |
| InChI | InChI=1S/C19H20N4O5/c1-20-15(24)7-5-11-3-2-4-12(9-11)21-13-10-17(26)23(19(13)28)14-6-8-16(25)22-18(14)27/h2-4,9-10,14,21H,5-8H2,1H3,(H,20,24)(H,22,25,27) |
| InChIKey | AMZYNXQXEGHYKC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|