C29H31N3O4 — CID 165073619
1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[2-methyl-5-(3-methylphenyl)-4-oxopentan-2-yl]anilino]pyrrole-2,5-dione (PubChem CID 165073619) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[2-methyl-5-(3-methylphenyl)-4-oxopentan-2-yl]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[2-methyl-5-(3-methylphenyl)-4-oxopentan-2-yl]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 165073619 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[2-methyl-5-(3-methylphenyl)-4-oxopentan-2-yl]anilino]pyrrole-2,5-dione |
| SMILES | C=C1CCC(N2C(=O)C=C(Nc3cccc(C(C)(C)CC(=O)Cc4cccc(C)c4)c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H31N3O4/c1-18-7-5-8-20(13-18)14-23(33)17-29(3,4)21-9-6-10-22(15-21)31-24-16-26(34)32(28(24)36)25-12-11-19(2)30-27(25)35/h5-10,13,15-16,25,31H,2,11-12,14,17H2,1,3-4H3,(H,30,35) |
| InChIKey | ZGPXUNBHSIKAQD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|