C24H22N2O4 — CID 157230699
2-(6-methylidene-2-oxopiperidin-3-yl)-5-(3-oxo-4-phenylbutyl)isoindole-1,3-dione (PubChem CID 157230699) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-(3-oxo-4-phenylbutyl)isoindole-1,3-dione.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-(3-oxo-4-phenylbutyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 157230699 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-(3-oxo-4-phenylbutyl)isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3ccc(CCC(=O)Cc4ccccc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22N2O4/c1-15-7-12-21(22(28)25-15)26-23(29)19-11-9-17(14-20(19)24(26)30)8-10-18(27)13-16-5-3-2-4-6-16/h2-6,9,11,14,21H,1,7-8,10,12-13H2,(H,25,28) |
| InChIKey | AUBIJWYNGGSJAO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|