C27H27N3O4 — CID 165021621
1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[4-(4-methylphenyl)-3-oxobutyl]anilino]pyrrole-2,5-dione (PubChem CID 165021621) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[4-(4-methylphenyl)-3-oxobutyl]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[4-(4-methylphenyl)-3-oxobutyl]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 165021621 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-(6-methylidene-2-oxopiperidin-3-yl)-3-[3-[4-(4-methylphenyl)-3-oxobutyl]anilino]pyrrole-2,5-dione |
| SMILES | C=C1CCC(N2C(=O)C=C(Nc3cccc(CCC(=O)Cc4ccc(C)cc4)c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H27N3O4/c1-17-6-9-20(10-7-17)15-22(31)12-11-19-4-3-5-21(14-19)29-23-16-25(32)30(27(23)34)24-13-8-18(2)28-26(24)33/h3-7,9-10,14,16,24,29H,2,8,11-13,15H2,1H3,(H,28,33) |
| InChIKey | YTXQVLOQGXRMHJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|