C19H19N3O5 — CID 165066116
ethyl 3-[[1-(6-methylidene-2-oxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 165066116) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl 3-[[1-(6-methylidene-2-oxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | ethyl 3-[[1-(6-methylidene-2-oxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 165066116 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | ethyl 3-[[1-(6-methylidene-2-oxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | C=C1CCC(N2C(=O)C=C(Nc3cccc(C(=O)OCC)c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H19N3O5/c1-3-27-19(26)12-5-4-6-13(9-12)21-14-10-16(23)22(18(14)25)15-8-7-11(2)20-17(15)24/h4-6,9-10,15,21H,2-3,7-8H2,1H3,(H,20,24) |
| InChIKey | DRYHCYBRTORHMC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|