C26H22N2O5 — CID 163259412
ethyl 3-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-5-yl]methyl]benzoate (PubChem CID 163259412) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is ethyl 3-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-5-yl]methyl]benzoate.
| Compound Name | ethyl 3-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 163259412 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl 3-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-5-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(Cc2ccc3c4c(cccc24)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C26H22N2O5/c1-2-33-26(32)17-6-3-5-15(14-17)13-16-9-10-19-23-18(16)7-4-8-20(23)28(25(19)31)21-11-12-22(29)27-24(21)30/h3-10,14,21H,2,11-13H2,1H3,(H,27,29,30) |
| InChIKey | BRDMOCIWGXTXMP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|