C24H21ClN4O5 — CID 146627956
N-(4-chlorophenyl)-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]propanamide (PubChem CID 146627956) has the molecular formula C24H21ClN4O5 and a molecular weight of 480.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 146627956 |
| Molecular Formula | C24H21ClN4O5 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-(4-chlorophenyl)-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]propanamide |
| SMILES | O=C1CCC(N2C(=O)C=C(Nc3cccc(CCC(=O)Nc4ccc(Cl)cc4)c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H21ClN4O5/c25-15-5-7-16(8-6-15)27-20(30)10-4-14-2-1-3-17(12-14)26-18-13-22(32)29(24(18)34)19-9-11-21(31)28-23(19)33/h1-3,5-8,12-13,19,26H,4,9-11H2,(H,27,30)(H,28,31,33) |
| InChIKey | SGTQONJZISQFNG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|