C16H14ClN3O4 — CID 146628561
3-[3-(3-chloro-4-methylanilino)-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 146628561) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is 3-[3-(3-chloro-4-methylanilino)-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-(3-chloro-4-methylanilino)-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146628561 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-[3-(3-chloro-4-methylanilino)-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)cc1Cl |
| InChI | InChI=1S/C16H14ClN3O4/c1-8-2-3-9(6-10(8)17)18-11-7-14(22)20(16(11)24)12-4-5-13(21)19-15(12)23/h2-3,6-7,12,18H,4-5H2,1H3,(H,19,21,23) |
| InChIKey | ISUGDOXMLSRCMB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|