C24H28ClN5O5 — CID 146666503
1-(3-chloro-4-methylphenyl)-3-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]cyclohexyl]methyl]urea (PubChem CID 146666503) has the molecular formula C24H28ClN5O5 and a molecular weight of 501.97 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]cyclohexyl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 146666503 |
| Molecular Formula | C24H28ClN5O5 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]cyclohexyl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC2CCCC(NC3=CC(=O)N(C4CCC(=O)NC4=O)C3=O)C2)cc1Cl |
| InChI | InChI=1S/C24H28ClN5O5/c1-13-5-6-16(10-17(13)25)28-24(35)26-12-14-3-2-4-15(9-14)27-18-11-21(32)30(23(18)34)19-7-8-20(31)29-22(19)33/h5-6,10-11,14-15,19,27H,2-4,7-9,12H2,1H3,(H2,26,28,35)(H,29,31,33) |
| InChIKey | DDFZUUSYZJCURJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|