C22H26N4O6 — CID 168803116
tert-butyl N-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 168803116) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is tert-butyl N-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168803116 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | tert-butyl N-[[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cccc(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26N4O6/c1-22(2,3)32-21(31)25(4)12-13-6-5-7-14(10-13)23-15-11-18(28)26(20(15)30)16-8-9-17(27)24-19(16)29/h5-7,10-11,16,23H,8-9,12H2,1-4H3,(H,24,27,29) |
| InChIKey | SBISEEPWFQQNFM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|