C27H25ClN2O5 — CID 165065193
3-[3-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]phenoxy]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione (PubChem CID 165065193) has the molecular formula C27H25ClN2O5 and a molecular weight of 492.96 g/mol. Its IUPAC name is 3-[3-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]phenoxy]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[3-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]phenoxy]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 165065193 |
| Molecular Formula | C27H25ClN2O5 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 3-[3-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]phenoxy]-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione |
| SMILES | C=C1CCC(N2C(=O)C=C(Oc3cccc(CCC(=O)Cc4ccc(C)c(Cl)c4)c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H25ClN2O5/c1-16-6-8-19(14-22(16)28)12-20(31)10-9-18-4-3-5-21(13-18)35-24-15-25(32)30(27(24)34)23-11-7-17(2)29-26(23)33/h3-6,8,13-15,23H,2,7,9-12H2,1H3,(H,29,33) |
| InChIKey | KSOZXADJZNPFDN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|