C25H22ClNO5 — CID 147267948
5-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione (PubChem CID 147267948) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is 5-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione.
| Compound Name | 5-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 147267948 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 5-[4-(3-chloro-4-methylphenyl)-3-oxobutyl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(CC(=O)CCc2ccc3c(c2)C(=O)N(C2CCC(=O)CC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C25H22ClNO5/c1-14-2-3-16(12-21(14)26)10-17(28)6-4-15-5-8-19-20(11-15)25(32)27(24(19)31)22-9-7-18(29)13-23(22)30/h2-3,5,8,11-12,22H,4,6-7,9-10,13H2,1H3 |
| InChIKey | CPVXZIXVEYMIGK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|