C24H24ClNO4S — CID 157060395
4-[3-[5-(3-chloro-4-methylphenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]cyclohexane-1,3-dione (PubChem CID 157060395) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is 4-[3-[5-(3-chloro-4-methylphenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[3-[5-(3-chloro-4-methylphenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 157060395 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 4-[3-[5-(3-chloro-4-methylphenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]cyclohexane-1,3-dione |
| SMILES | Cc1ccc(CCC(=O)CCc2scc3c2CN(C2CCC(=O)CC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C24H24ClNO4S/c1-14-2-3-15(10-20(14)25)4-5-16(27)7-9-23-18-12-26(24(30)19(18)13-31-23)21-8-6-17(28)11-22(21)29/h2-3,10,13,21H,4-9,11-12H2,1H3 |
| InChIKey | ABGPSCMSEBMLTL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|