C24H23NO6S — CID 157173476
4-[6-[3-(4-methylsulfonylphenyl)-3-oxopropyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 157173476) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-[6-[3-(4-methylsulfonylphenyl)-3-oxopropyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[6-[3-(4-methylsulfonylphenyl)-3-oxopropyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 157173476 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 4-[6-[3-(4-methylsulfonylphenyl)-3-oxopropyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(C(=O)CCc2ccc3c(c2)CN(C2CCC(=O)CC2=O)C3=O)cc1 |
| InChI | InChI=1S/C24H23NO6S/c1-32(30,31)19-7-4-16(5-8-19)22(27)11-3-15-2-9-20-17(12-15)14-25(24(20)29)21-10-6-18(26)13-23(21)28/h2,4-5,7-9,12,21H,3,6,10-11,13-14H2,1H3 |
| InChIKey | ANSXTRWXEOMRFH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|