C24H23FN2O4 — CID 158268472
2-(2,4-dioxocyclohexyl)-N-[(1R)-1-(2-fluorophenyl)propyl]-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 158268472) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-N-[(1R)-1-(2-fluorophenyl)propyl]-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,4-dioxocyclohexyl)-N-[(1R)-1-(2-fluorophenyl)propyl]-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 158268472 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-N-[(1R)-1-(2-fluorophenyl)propyl]-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1ccc2c(c1)CN(C1CCC(=O)CC1=O)C2=O)c1ccccc1F |
| InChI | InChI=1S/C24H23FN2O4/c1-2-20(18-5-3-4-6-19(18)25)26-23(30)14-7-9-17-15(11-14)13-27(24(17)31)21-10-8-16(28)12-22(21)29/h3-7,9,11,20-21H,2,8,10,12-13H2,1H3,(H,26,30)/t20-,21?/m1/s1 |
| InChIKey | GISYAELXJXXGGY-VQCQRNETSA-N |
| XLogP | 3.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|