C23H20F2N2O4 — CID 159944577
2-(2,4-dioxocyclohexyl)-4-fluoro-N-[(1S)-1-(2-fluorophenyl)ethyl]-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 159944577) has the molecular formula C23H20F2N2O4 and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-fluoro-N-[(1S)-1-(2-fluorophenyl)ethyl]-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-fluoro-N-[(1S)-1-(2-fluorophenyl)ethyl]-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 159944577 |
| Molecular Formula | C23H20F2N2O4 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-fluoro-N-[(1S)-1-(2-fluorophenyl)ethyl]-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1F)CN(C1CCC(=O)CC1=O)C2=O)c1ccccc1F |
| InChI | InChI=1S/C23H20F2N2O4/c1-12(14-4-2-3-5-18(14)24)26-22(30)16-8-7-15-17(21(16)25)11-27(23(15)31)19-9-6-13(28)10-20(19)29/h2-5,7-8,12,19H,6,9-11H2,1H3,(H,26,30)/t12-,19?/m0/s1 |
| InChIKey | OBIASSDXUVJRNA-HSLMYDHPSA-N |
| XLogP | 3.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|