C26H26N2O5 — CID 158383440
N-[(1S)-1-(2-cyclopropyloxyphenyl)ethyl]-2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 158383440) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[(1S)-1-(2-cyclopropyloxyphenyl)ethyl]-2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[(1S)-1-(2-cyclopropyloxyphenyl)ethyl]-2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 158383440 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[(1S)-1-(2-cyclopropyloxyphenyl)ethyl]-2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)CN(C1CCC(=O)CC1=O)C2=O)c1ccccc1OC1CC1 |
| InChI | InChI=1S/C26H26N2O5/c1-15(20-4-2-3-5-24(20)33-19-8-9-19)27-25(31)16-6-10-21-17(12-16)14-28(26(21)32)22-11-7-18(29)13-23(22)30/h2-6,10,12,15,19,22H,7-9,11,13-14H2,1H3,(H,27,31)/t15-,22?/m0/s1 |
| InChIKey | GWBSPRRDMXBCQN-UEDXYCIISA-N |
| XLogP | 3.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|