C22H19ClFN3O4 — CID 155338954
N-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 155338954) has the molecular formula C22H19ClFN3O4 and a molecular weight of 443.86 g/mol. Its IUPAC name is N-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 155338954 |
| Molecular Formula | C22H19ClFN3O4 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | N-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H19ClFN3O4/c1-11(15-5-3-14(24)9-17(15)23)25-20(29)12-2-4-16-13(8-12)10-27(22(16)31)18-6-7-19(28)26-21(18)30/h2-5,8-9,11,18H,6-7,10H2,1H3,(H,25,29)(H,26,28,30)/t11-,18?/m0/s1 |
| InChIKey | SQUGKUVPVDBGGA-FAQQKDIKSA-N |
| XLogP | 2.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|