C26H27NO6 — CID 157163925
4-[6-[4-(3,4-dimethoxyphenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 157163925) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 4-[6-[4-(3,4-dimethoxyphenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[6-[4-(3,4-dimethoxyphenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 157163925 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-[6-[4-(3,4-dimethoxyphenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | COc1ccc(CC(=O)CCc2ccc3c(c2)CN(C2CCC(=O)CC2=O)C3=O)cc1OC |
| InChI | InChI=1S/C26H27NO6/c1-32-24-10-5-17(13-25(24)33-2)12-19(28)6-3-16-4-8-21-18(11-16)15-27(26(21)31)22-9-7-20(29)14-23(22)30/h4-5,8,10-11,13,22H,3,6-7,9,12,14-15H2,1-2H3 |
| InChIKey | AMRPQWKIDMOBCG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|