C25H25F2N3O4 — CID 157339090
N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yl-2-pyridinyl)acetamide (PubChem CID 157339090) has the molecular formula C25H25F2N3O4 and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yl-2-pyridinyl)acetamide.
| Compound Name | N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 157339090 |
| Molecular Formula | C25H25F2N3O4 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yl-2-pyridinyl)acetamide |
| SMILES | CC(C)c1ccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)CC2=O)C3=O)nc1 |
| InChI | InChI=1S/C25H25F2N3O4/c1-14(2)16-4-8-22(28-12-16)25(26,27)24(34)29-11-15-3-6-19-17(9-15)13-30(23(19)33)20-7-5-18(31)10-21(20)32/h3-4,6,8-9,12,14,20H,5,7,10-11,13H2,1-2H3,(H,29,34) |
| InChIKey | BGEMECBXOALFKE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|