C28H30F2N2O6 — CID 139457264
N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-propan-2-yloxyethoxy)phenyl]acetamide (PubChem CID 139457264) has the molecular formula C28H30F2N2O6 and a molecular weight of 528.55 g/mol. Its IUPAC name is N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-propan-2-yloxyethoxy)phenyl]acetamide.
| Compound Name | N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-propan-2-yloxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 139457264 |
| Molecular Formula | C28H30F2N2O6 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-propan-2-yloxyethoxy)phenyl]acetamide |
| SMILES | CC(C)OCCOc1cccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)CC2=O)C3=O)c1 |
| InChI | InChI=1S/C28H30F2N2O6/c1-17(2)37-10-11-38-22-5-3-4-20(13-22)28(29,30)27(36)31-15-18-6-8-23-19(12-18)16-32(26(23)35)24-9-7-21(33)14-25(24)34/h3-6,8,12-13,17,24H,7,9-11,14-16H2,1-2H3,(H,31,36) |
| InChIKey | JWLMXNLGEZMRLN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|