C22H20F2N4O4 — CID 175954652
N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-methyl-2-pyridinyl)acetamide (PubChem CID 175954652) has the molecular formula C22H20F2N4O4 and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-methyl-2-pyridinyl)acetamide.
| Compound Name | N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 175954652 |
| Molecular Formula | C22H20F2N4O4 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[[2-[(3R)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1ccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN([C@@H]2CCC(=O)NC2=O)C3=O)nc1 |
| InChI | InChI=1S/C22H20F2N4O4/c1-12-2-6-17(25-9-12)22(23,24)21(32)26-10-13-3-4-15-14(8-13)11-28(20(15)31)16-5-7-18(29)27-19(16)30/h2-4,6,8-9,16H,5,7,10-11H2,1H3,(H,26,32)(H,27,29,30)/t16-/m1/s1 |
| InChIKey | GRFBTHLLUKYPJX-MRXNPFEDSA-N |
| XLogP | 1.56 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|