C31H37ClN2O4S — CID 164985781
3-[6-[11-(3-chloro-4-methylphenyl)-10-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164985781) has the molecular formula C31H37ClN2O4S and a molecular weight of 569.17 g/mol. Its IUPAC name is 3-[6-[11-(3-chloro-4-methylphenyl)-10-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[11-(3-chloro-4-methylphenyl)-10-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164985781 |
| Molecular Formula | C31H37ClN2O4S |
| Molecular Weight | 569.17 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 3-[6-[11-(3-chloro-4-methylphenyl)-10-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(CC(=O)CCCCCCCCCSc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C31H37ClN2O4S/c1-21-10-11-22(18-27(21)32)17-24(35)9-7-5-3-2-4-6-8-16-39-25-12-13-26-23(19-25)20-34(31(26)38)28-14-15-29(36)33-30(28)37/h10-13,18-19,28H,2-9,14-17,20H2,1H3,(H,33,36,37) |
| InChIKey | GDHAJZAQOPGNIQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.17 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|