C18H19FN2O7 — CID 164846631
[3-(6-fluoro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-methoxyethyl carbonate (PubChem CID 164846631) has the molecular formula C18H19FN2O7 and a molecular weight of 394.36 g/mol. Its IUPAC name is [3-(6-fluoro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-methoxyethyl carbonate.
| Compound Name | [3-(6-fluoro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 164846631 |
| Molecular Formula | C18H19FN2O7 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [3-(6-fluoro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCN1C(=O)CCC(N2Cc3cc(F)ccc3C2=O)C1=O |
| InChI | InChI=1S/C18H19FN2O7/c1-26-6-7-27-18(25)28-10-21-15(22)5-4-14(17(21)24)20-9-11-8-12(19)2-3-13(11)16(20)23/h2-3,8,14H,4-7,9-10H2,1H3 |
| InChIKey | OPYBBBIYGLXVMV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|