C30H32F3N3O5 — CID 160617798
1-[[(3S)-3-amino-4-methylpent-1-en-2-yl]oxymethyl]-3-[6-[4,4-difluoro-4-(4-fluorophenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 160617798) has the molecular formula C30H32F3N3O5 and a molecular weight of 571.60 g/mol. Its IUPAC name is 1-[[(3S)-3-amino-4-methylpent-1-en-2-yl]oxymethyl]-3-[6-[4,4-difluoro-4-(4-fluorophenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 1-[[(3S)-3-amino-4-methylpent-1-en-2-yl]oxymethyl]-3-[6-[4,4-difluoro-4-(4-fluorophenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 160617798 |
| Molecular Formula | C30H32F3N3O5 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 1-[[(3S)-3-amino-4-methylpent-1-en-2-yl]oxymethyl]-3-[6-[4,4-difluoro-4-(4-fluorophenyl)-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C(OCN1C(=O)CCC(N2Cc3cc(CCC(=O)C(F)(F)c4ccc(F)cc4)ccc3C2=O)C1=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C30H32F3N3O5/c1-17(2)27(34)18(3)41-16-36-26(38)13-11-24(29(36)40)35-15-20-14-19(4-10-23(20)28(35)39)5-12-25(37)30(32,33)21-6-8-22(31)9-7-21/h4,6-10,14,17,24,27H,3,5,11-13,15-16,34H2,1-2H3/t24?,27-/m0/s1 |
| InChIKey | BGRQBQRPVRZQMD-WKDCXCOVSA-N |
| XLogP | 4.06 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|