C23H19ClF2N2O4 — CID 159983441
3-[6-[4-(4-chlorophenyl)-1-deuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1-deuteriopiperidine-2,6-dione (PubChem CID 159983441) has the molecular formula C23H19ClF2N2O4 and a molecular weight of 462.88 g/mol. Its IUPAC name is 3-[6-[4-(4-chlorophenyl)-1-deuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1-deuteriopiperidine-2,6-dione.
| Compound Name | 3-[6-[4-(4-chlorophenyl)-1-deuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1-deuteriopiperidine-2,6-dione |
|---|---|
| PubChem CID | 159983441 |
| Molecular Formula | C23H19ClF2N2O4 |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 3-[6-[4-(4-chlorophenyl)-1-deuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1-deuteriopiperidine-2,6-dione |
| SMILES | [2H]C(CC(=O)C(F)(F)c1ccc(Cl)cc1)c1ccc2c(c1)CN(C1CCC(=O)N([2H])C1=O)C2=O |
| InChI | InChI=1S/C23H19ClF2N2O4/c24-16-5-3-15(4-6-16)23(25,26)19(29)9-2-13-1-7-17-14(11-13)12-28(22(17)32)18-8-10-20(30)27-21(18)31/h1,3-7,11,18H,2,8-10,12H2,(H,27,30,31)/i2D/hD |
| InChIKey | OGAORUKJHIAKFI-YQWZEFQTSA-N |
| XLogP | 3.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|