C22H18ClF2N3O4 — CID 156628933
2-(4-chlorophenyl)-N-deuterio-N-[deuterio-[1-oxo-2-(1,4,4,5-tetradeuterio-2,6-dioxopiperidin-3-yl)-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide (PubChem CID 156628933) has the molecular formula C22H18ClF2N3O4 and a molecular weight of 467.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-deuterio-N-[deuterio-[1-oxo-2-(1,4,4,5-tetradeuterio-2,6-dioxopiperidin-3-yl)-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-deuterio-N-[deuterio-[1-oxo-2-(1,4,4,5-tetradeuterio-2,6-dioxopiperidin-3-yl)-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 156628933 |
| Molecular Formula | C22H18ClF2N3O4 |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-deuterio-N-[deuterio-[1-oxo-2-(1,4,4,5-tetradeuterio-2,6-dioxopiperidin-3-yl)-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
| SMILES | [2H]C(c1ccc2c(c1)CN(C1C(=O)N([2H])C(=O)C([2H])C1([2H])[2H])C2=O)N([2H])C(=O)C(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClF2N3O4/c23-15-4-2-14(3-5-15)22(24,25)21(32)26-10-12-1-6-16-13(9-12)11-28(20(16)31)17-7-8-18(29)27-19(17)30/h1-6,9,17H,7-8,10-11H2,(H,26,32)(H,27,29,30)/i7D2,8D,10D/hD2 |
| InChIKey | PWBHUSLMHZLGRN-MNFMYQJOSA-N |
| XLogP | 2.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|