C23H19ClF2N2O4 — CID 159983394
(3S)-3-[6-[4-(4-chlorophenyl)-1,1-dideuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1,3,4-trideuteriopiperidine-2,6-dione (PubChem CID 159983394) has the molecular formula C23H19ClF2N2O4 and a molecular weight of 465.89 g/mol. Its IUPAC name is (3S)-3-[6-[4-(4-chlorophenyl)-1,1-dideuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1,3,4-trideuteriopiperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[4-(4-chlorophenyl)-1,1-dideuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1,3,4-trideuteriopiperidine-2,6-dione |
|---|---|
| PubChem CID | 159983394 |
| Molecular Formula | C23H19ClF2N2O4 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (3S)-3-[6-[4-(4-chlorophenyl)-1,1-dideuterio-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]-1,3,4-trideuteriopiperidine-2,6-dione |
| SMILES | [2H]C1CC(=O)N([2H])C(=O)[C@@]1([2H])N1Cc2cc(C([2H])([2H])CC(=O)C(F)(F)c3ccc(Cl)cc3)ccc2C1=O |
| InChI | InChI=1S/C23H19ClF2N2O4/c24-16-5-3-15(4-6-16)23(25,26)19(29)9-2-13-1-7-17-14(11-13)12-28(22(17)32)18-8-10-20(30)27-21(18)31/h1,3-7,11,18H,2,8-10,12H2,(H,27,30,31)/t18-/m0/s1/i2D2,8D,18D/hD/t8?,18- |
| InChIKey | OGAORUKJHIAKFI-TUXZFQEDSA-N |
| XLogP | 3.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|