C25H23NO6 — CID 157494391
2-(2,4-dioxocyclohexyl)-5-[3-(4-ethoxyphenyl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 157494391) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-5-[3-(4-ethoxyphenyl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-5-[3-(4-ethoxyphenyl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 157494391 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-5-[3-(4-ethoxyphenyl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | CCOc1ccc(C(=O)CCc2ccc3c(c2)C(=O)N(C2CCC(=O)CC2=O)C3=O)cc1 |
| InChI | InChI=1S/C25H23NO6/c1-2-32-18-8-5-16(6-9-18)22(28)12-4-15-3-10-19-20(13-15)25(31)26(24(19)30)21-11-7-17(27)14-23(21)29/h3,5-6,8-10,13,21H,2,4,7,11-12,14H2,1H3 |
| InChIKey | BXQOSBDCTNDNLG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|